C25H26N4O4S2 — CID 2095839
4-(dimethylsulfamoyl)-N-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]benzamide (PubChem CID 2095839) has the molecular formula C25H26N4O4S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2095839 |
| Molecular Formula | C25H26N4O4S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[4-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1ccc(-n2c(C)cc(-c3csc(NC(=O)c4ccc(S(=O)(=O)N(C)C)cc4)n3)c2C)cc1 |
| InChI | InChI=1S/C25H26N4O4S2/c1-16-14-22(17(2)29(16)19-8-10-20(33-5)11-9-19)23-15-34-25(26-23)27-24(30)18-6-12-21(13-7-18)35(31,32)28(3)4/h6-15H,1-5H3,(H,26,27,30) |
| InChIKey | DHMJOCZUZNZUAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|