About N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide
N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide (PubChem CID 20958589) has the molecular formula C12H15N3O4S
and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
| PubChem CID | 20958589 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cn(C)cn2)cc(OC)c1 |
| InChI | InChI=1S/C12H15N3O4S/c1-15-7-12(13-8-15)20(16,17)14-9-4-10(18-2)6-11(5-9)19-3/h4-8,14H,1-3H3 |
| InChIKey | WURBPPWJNPPBAF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide?
The IUPAC name of N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide (CID 20958589) is N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide?
The canonical SMILES for N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide is COc1cc(NS(=O)(=O)c2cn(C)cn2)cc(OC)c1.
What is the InChIKey of N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide?
The InChIKey is WURBPPWJNPPBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4S/c1-15-7-12(13-8-15)20(16,17)14-9-4-10(18-2)6-11(5-9)19-3/h4-8,14H,1-3H3.
What are the key properties of N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide?
N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide has a molecular weight of 297.34 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethoxyphenyl)-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 20958589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).