About 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide
1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide (PubChem CID 20958605) has the molecular formula C13H17N3O5S
and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide |
| PubChem CID | 20958605 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cn(C)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C13H17N3O5S/c1-16-7-12(14-8-16)22(17,18)15-9-5-10(19-2)13(21-4)11(6-9)20-3/h5-8,15H,1-4H3 |
| InChIKey | IVRQNOXUOJKSCN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide?
The IUPAC name of 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide (CID 20958605) is 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide.
What is the SMILES notation for 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide?
The canonical SMILES for 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide is COc1cc(NS(=O)(=O)c2cn(C)cn2)cc(OC)c1OC.
What is the InChIKey of 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide?
The InChIKey is IVRQNOXUOJKSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5S/c1-16-7-12(14-8-16)22(17,18)15-9-5-10(19-2)13(21-4)11(6-9)20-3/h5-8,15H,1-4H3.
What are the key properties of 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide?
1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide has a molecular weight of 327.36 g/mol, XLogP of 1.25, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(3,4,5-trimethoxyphenyl)imidazole-4-sulfonamide is sourced from PubChem (CID 20958605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).