About N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide
N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 20958634) has the molecular formula C16H23N3O4S
and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide |
| PubChem CID | 20958634 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2cn(C)cn2)cc1OCC |
| InChI | InChI=1S/C16H23N3O4S/c1-4-22-14-7-6-13(10-15(14)23-5-2)8-9-18-24(20,21)16-11-19(3)12-17-16/h6-7,10-12,18H,4-5,8-9H2,1-3H3 |
| InChIKey | BXDZXAODQFXORY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide?
The IUPAC name of N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide (CID 20958634) is N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide?
The canonical SMILES for N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide is CCOc1ccc(CCNS(=O)(=O)c2cn(C)cn2)cc1OCC.
What is the InChIKey of N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide?
The InChIKey is BXDZXAODQFXORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O4S/c1-4-22-14-7-6-13(10-15(14)23-5-2)8-9-18-24(20,21)16-11-19(3)12-17-16/h6-7,10-12,18H,4-5,8-9H2,1-3H3.
What are the key properties of N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide?
N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide has a molecular weight of 353.44 g/mol, XLogP of 1.74, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-diethoxyphenyl)ethyl]-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 20958634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).