About 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide (PubChem CID 20959093) has the molecular formula C21H22N2O3S
and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide |
| PubChem CID | 20959093 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide |
| SMILES | CC(C)c1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-14(2)15-5-9-18(10-6-15)23-27(24,25)19-11-7-16(8-12-19)20-13-22-21(26-20)17-3-4-17/h5-14,17,23H,3-4H2,1-2H3 |
| InChIKey | NQVFFOHAGVLTKQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide?
The IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide (CID 20959093) is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide?
The canonical SMILES for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide is CC(C)c1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1.
What is the InChIKey of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide?
The InChIKey is NQVFFOHAGVLTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3S/c1-14(2)15-5-9-18(10-6-15)23-27(24,25)19-11-7-16(8-12-19)20-13-22-21(26-20)17-3-4-17/h5-14,17,23H,3-4H2,1-2H3.
What are the key properties of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide?
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide has a molecular weight of 382.49 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-propan-2-ylphenyl)benzenesulfonamide is sourced from PubChem (CID 20959093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).