About 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 20959106) has the molecular formula C19H18N2O3S
and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide |
| PubChem CID | 20959106 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-13-2-8-16(9-3-13)21-25(22,23)17-10-6-14(7-11-17)18-12-20-19(24-18)15-4-5-15/h2-3,6-12,15,21H,4-5H2,1H3 |
| InChIKey | JBFPESZNTFXRNR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide?
The IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide (CID 20959106) is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide?
The canonical SMILES for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(-c3cnc(C4CC4)o3)cc2)cc1.
What is the InChIKey of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide?
The InChIKey is JBFPESZNTFXRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3S/c1-13-2-8-16(9-3-13)21-25(22,23)17-10-6-14(7-11-17)18-12-20-19(24-18)15-4-5-15/h2-3,6-12,15,21H,4-5H2,1H3.
What are the key properties of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide?
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide has a molecular weight of 354.43 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-(4-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 20959106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).