About 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide (PubChem CID 20959115) has the molecular formula C21H17N3O4S
and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide |
| PubChem CID | 20959115 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccno2)cc1)c1ccc(-c2cnc(C3CC3)o2)cc1 |
| InChI | InChI=1S/C21H17N3O4S/c25-29(26,24-17-7-3-14(4-8-17)19-11-12-23-28-19)18-9-5-15(6-10-18)20-13-22-21(27-20)16-1-2-16/h3-13,16,24H,1-2H2 |
| InChIKey | UFQJEEBDLLAYGG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide?
The IUPAC name of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide (CID 20959115) is 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide?
The canonical SMILES for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide is O=S(=O)(Nc1ccc(-c2ccno2)cc1)c1ccc(-c2cnc(C3CC3)o2)cc1.
What is the InChIKey of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide?
The InChIKey is UFQJEEBDLLAYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O4S/c25-29(26,24-17-7-3-14(4-8-17)19-11-12-23-28-19)18-9-5-15(6-10-18)20-13-22-21(27-20)16-1-2-16/h3-13,16,24H,1-2H2.
What are the key properties of 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide?
4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide has a molecular weight of 407.45 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclopropyl-1,3-oxazol-5-yl)-N-[4-(1,2-oxazol-5-yl)phenyl]benzenesulfonamide is sourced from PubChem (CID 20959115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).