C24H26N4O4 — CID 20960592
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(3,4-dimethoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 20960592) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(3,4-dimethoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(3,4-dimethoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 20960592 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(3,4-dimethoxyphenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | COc1ccc(CN2CCc3nc(Nc4ccc5c(c4)OCCO5)ncc3C2)cc1OC |
| InChI | InChI=1S/C24H26N4O4/c1-29-20-5-3-16(11-22(20)30-2)14-28-8-7-19-17(15-28)13-25-24(27-19)26-18-4-6-21-23(12-18)32-10-9-31-21/h3-6,11-13H,7-10,14-15H2,1-2H3,(H,25,26,27) |
| InChIKey | XMTUPNMVGGDNBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |