About N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide
N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide (PubChem CID 20961888) has the molecular formula C15H12FN3O2S2
and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide |
| PubChem CID | 20961888 |
| Molecular Formula | C15H12FN3O2S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1cc(=O)n2ccsc2n1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FN3O2S2/c16-10-1-3-11(4-2-10)17-13(20)9-22-8-12-7-14(21)19-5-6-23-15(19)18-12/h1-7H,8-9H2,(H,17,20) |
| InChIKey | DXIQIGHLBITUIL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide?
The IUPAC name of N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide (CID 20961888) is N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide.
What is the SMILES notation for N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide?
The canonical SMILES for N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide is O=C(CSCc1cc(=O)n2ccsc2n1)Nc1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide?
The InChIKey is DXIQIGHLBITUIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O2S2/c16-10-1-3-11(4-2-10)17-13(20)9-22-8-12-7-14(21)19-5-6-23-15(19)18-12/h1-7H,8-9H2,(H,17,20).
What are the key properties of N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide?
N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide has a molecular weight of 349.41 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetamide is sourced from PubChem (CID 20961888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).