C18H20N4O3S2 — CID 20961974
2-[[2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methylsulfanyl]-N-phenylacetamide (PubChem CID 20961974) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methylsulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methylsulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 20961974 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[[2-(2-ethoxyethyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl]methylsulfanyl]-N-phenylacetamide |
| SMILES | CCOCCc1nn2c(=O)cc(CSCC(=O)Nc3ccccc3)nc2s1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-2-25-9-8-16-21-22-17(24)10-14(20-18(22)27-16)11-26-12-15(23)19-13-6-4-3-5-7-13/h3-7,10H,2,8-9,11-12H2,1H3,(H,19,23) |
| InChIKey | HNTFLKWLOSIXHD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|