About 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide
4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide (PubChem CID 20962015) has the molecular formula C18H21N3O3S
and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide |
| PubChem CID | 20962015 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc3c(cc2C)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-5-13-6-8-14(9-7-13)25(23,24)19-15-11-17-16(10-12(15)2)20(3)18(22)21(17)4/h6-11,19H,5H2,1-4H3 |
| InChIKey | QYOSVLFVQJCFJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The IUPAC name of 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide (CID 20962015) is 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide.
What is the SMILES notation for 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The canonical SMILES for 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide is CCc1ccc(S(=O)(=O)Nc2cc3c(cc2C)n(C)c(=O)n3C)cc1.
What is the InChIKey of 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
The InChIKey is QYOSVLFVQJCFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3S/c1-5-13-6-8-14(9-7-13)25(23,24)19-15-11-17-16(10-12(15)2)20(3)18(22)21(17)4/h6-11,19H,5H2,1-4H3.
What are the key properties of 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide?
4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide has a molecular weight of 359.45 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzenesulfonamide is sourced from PubChem (CID 20962015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).