About 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide
4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide (PubChem CID 20962754) has the molecular formula C17H20N2O4S2
and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide |
| PubChem CID | 20962754 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-18(15-7-3-2-4-8-15)25(22,23)17-11-9-16(10-12-17)19-13-5-6-14-24(19,20)21/h2-4,7-12H,5-6,13-14H2,1H3 |
| InChIKey | VVLIWFOGZPRQKX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide?
The IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide (CID 20962754) is 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide.
What is the SMILES notation for 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide?
The canonical SMILES for 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide is CN(c1ccccc1)S(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1.
What is the InChIKey of 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide?
The InChIKey is VVLIWFOGZPRQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4S2/c1-18(15-7-3-2-4-8-15)25(22,23)17-11-9-16(10-12-17)19-13-5-6-14-24(19,20)21/h2-4,7-12H,5-6,13-14H2,1H3.
What are the key properties of 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide?
4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide has a molecular weight of 380.49 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiazinan-2-yl)-N-methyl-N-phenylbenzenesulfonamide is sourced from PubChem (CID 20962754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).