C18H15ClN2O4 — CID 20963819
N-(3-chlorophenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 20963819) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 20963819 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(3-chlorophenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(-c2ocnc2C(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H15ClN2O4/c1-23-14-7-6-11(8-15(14)24-2)17-16(20-10-25-17)18(22)21-13-5-3-4-12(19)9-13/h3-10H,1-2H3,(H,21,22) |
| InChIKey | GABPHBIAYJENHK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |