About ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate
ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate (PubChem CID 20964023) has the molecular formula C14H24N4O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate |
| PubChem CID | 20964023 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCc1c(C)nn(CC)c1C |
| InChI | InChI=1S/C14H24N4O3/c1-5-18-11(4)12(10(3)17-18)7-8-15-14(20)16-9-13(19)21-6-2/h5-9H2,1-4H3,(H2,15,16,20) |
| InChIKey | CJRUHFLEFQGLEE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate?
The IUPAC name of ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate (CID 20964023) is ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate.
What is the SMILES notation for ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate?
The canonical SMILES for ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate is CCOC(=O)CNC(=O)NCCc1c(C)nn(CC)c1C.
What is the InChIKey of ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate?
The InChIKey is CJRUHFLEFQGLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O3/c1-5-18-11(4)12(10(3)17-18)7-8-15-14(20)16-9-13(19)21-6-2/h5-9H2,1-4H3,(H2,15,16,20).
What are the key properties of ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate?
ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate has a molecular weight of 296.37 g/mol, XLogP of 0.92, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethylcarbamoylamino]acetate is sourced from PubChem (CID 20964023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).