About 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea
1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea (PubChem CID 20964048) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
| PubChem CID | 20964048 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
| SMILES | CCc1ccc(NC(=O)NCc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-5-13-6-8-14(9-7-13)18-16(21)17-10-15-11(2)19-20(4)12(15)3/h6-9H,5,10H2,1-4H3,(H2,17,18,21) |
| InChIKey | CHWRVGCUQIDAPU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea?
The IUPAC name of 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea (CID 20964048) is 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea.
What is the SMILES notation for 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea?
The canonical SMILES for 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea is CCc1ccc(NC(=O)NCc2c(C)nn(C)c2C)cc1.
What is the InChIKey of 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea?
The InChIKey is CHWRVGCUQIDAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-5-13-6-8-14(9-7-13)18-16(21)17-10-15-11(2)19-20(4)12(15)3/h6-9H,5,10H2,1-4H3,(H2,17,18,21).
What are the key properties of 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea?
1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea has a molecular weight of 286.38 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylphenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea is sourced from PubChem (CID 20964048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).