About ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate
ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate (PubChem CID 20964084) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate |
| PubChem CID | 20964084 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H20N4O3/c1-5-19-11(17)7-14-12(18)13-6-10-8(2)15-16(4)9(10)3/h5-7H2,1-4H3,(H2,13,14,18) |
| InChIKey | NFYGHHQSJWCMMT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate?
The IUPAC name of ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate (CID 20964084) is ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate.
What is the SMILES notation for ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate?
The canonical SMILES for ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate is CCOC(=O)CNC(=O)NCc1c(C)nn(C)c1C.
What is the InChIKey of ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate?
The InChIKey is NFYGHHQSJWCMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-5-19-11(17)7-14-12(18)13-6-10-8(2)15-16(4)9(10)3/h5-7H2,1-4H3,(H2,13,14,18).
What are the key properties of ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate?
ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate has a molecular weight of 268.32 g/mol, XLogP of 0.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1,3,5-trimethylpyrazol-4-yl)methylcarbamoylamino]acetate is sourced from PubChem (CID 20964084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).