About 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide
2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (PubChem CID 2096457) has the molecular formula C21H20FN3O
and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| PubChem CID | 2096457 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| SMILES | CCN1CCc2nc3ccccc3c(C(=O)Nc3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C21H20FN3O/c1-2-25-12-11-19-17(13-25)20(16-5-3-4-6-18(16)24-19)21(26)23-15-9-7-14(22)8-10-15/h3-10H,2,11-13H2,1H3,(H,23,26) |
| InChIKey | XOJLUIJWQDLGFT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide?
The IUPAC name of 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (CID 2096457) is 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
What is the SMILES notation for 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide?
The canonical SMILES for 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide is CCN1CCc2nc3ccccc3c(C(=O)Nc3ccc(F)cc3)c2C1.
What is the InChIKey of 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide?
The InChIKey is XOJLUIJWQDLGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O/c1-2-25-12-11-19-17(13-25)20(16-5-3-4-6-18(16)24-19)21(26)23-15-9-7-14(22)8-10-15/h3-10H,2,11-13H2,1H3,(H,23,26).
What are the key properties of 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide?
2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide has a molecular weight of 349.41 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(4-fluorophenyl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide is sourced from PubChem (CID 2096457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).