C26H34N4OS — CID 20966455
6-methyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]thieno[2,3-b]quinoline-2-carboxamide (PubChem CID 20966455) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 6-methyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]thieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | 6-methyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]thieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20966455 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 6-methyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]thieno[2,3-b]quinoline-2-carboxamide |
| SMILES | Cc1ccc2nc3sc(C(=O)NCCCN4CCC(N5CCCCC5)CC4)cc3cc2c1 |
| InChI | InChI=1S/C26H34N4OS/c1-19-6-7-23-20(16-19)17-21-18-24(32-26(21)28-23)25(31)27-10-5-11-29-14-8-22(9-15-29)30-12-3-2-4-13-30/h6-7,16-18,22H,2-5,8-15H2,1H3,(H,27,31) |
| InChIKey | CAZLGSSILVTPGK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|