C18H21N3O3S — CID 20966659
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea (PubChem CID 20966659) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea |
|---|---|
| PubChem CID | 20966659 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)Nc1nc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C18H21N3O3S/c22-17(19-12-7-8-14-15(11-12)24-10-9-23-14)21-18-20-13-5-3-1-2-4-6-16(13)25-18/h7-8,11H,1-6,9-10H2,(H2,19,20,21,22) |
| InChIKey | CIMLTKQCXXZMOM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |