C24H16BrF3N2O — CID 20966868
3-(2-bromo-4-methylphenyl)-2-[(Z)-2-[3-(trifluoromethyl)phenyl]ethenyl]quinazolin-4-one (PubChem CID 20966868) has the molecular formula C24H16BrF3N2O and a molecular weight of 485.30 g/mol. Its IUPAC name is 3-(2-bromo-4-methylphenyl)-2-[(Z)-2-[3-(trifluoromethyl)phenyl]ethenyl]quinazolin-4-one.
| Compound Name | 3-(2-bromo-4-methylphenyl)-2-[(Z)-2-[3-(trifluoromethyl)phenyl]ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 20966868 |
| Molecular Formula | C24H16BrF3N2O |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 3-(2-bromo-4-methylphenyl)-2-[(Z)-2-[3-(trifluoromethyl)phenyl]ethenyl]quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(/C=C\c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c(Br)c1 |
| InChI | InChI=1S/C24H16BrF3N2O/c1-15-9-11-21(19(25)13-15)30-22(29-20-8-3-2-7-18(20)23(30)31)12-10-16-5-4-6-17(14-16)24(26,27)28/h2-14H,1H3/b12-10- |
| InChIKey | MGFVUTUUIRFRGH-BENRWUELSA-N |
| XLogP | 6.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |