C24H26N2O3 — CID 20967178
ethyl 1'-benzyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate (PubChem CID 20967178) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 1'-benzyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate.
| Compound Name | ethyl 1'-benzyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 20967178 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 1'-benzyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxylate |
| SMILES | CCOC(=O)C1CC2CCCN2C12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C24H26N2O3/c1-2-29-22(27)20-15-18-11-8-14-26(18)24(20)19-12-6-7-13-21(19)25(23(24)28)16-17-9-4-3-5-10-17/h3-7,9-10,12-13,18,20H,2,8,11,14-16H2,1H3 |
| InChIKey | JSPQCGNBGKHZMJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |