C22H37N3O3S — CID 20968188
1-[bis(2-methylpropyl)sulfamoyl]-N-(1-phenylethyl)piperidine-4-carboxamide (PubChem CID 20968188) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is 1-[bis(2-methylpropyl)sulfamoyl]-N-(1-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[bis(2-methylpropyl)sulfamoyl]-N-(1-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20968188 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1-[bis(2-methylpropyl)sulfamoyl]-N-(1-phenylethyl)piperidine-4-carboxamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)N1CCC(C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H37N3O3S/c1-17(2)15-25(16-18(3)4)29(27,28)24-13-11-21(12-14-24)22(26)23-19(5)20-9-7-6-8-10-20/h6-10,17-19,21H,11-16H2,1-5H3,(H,23,26) |
| InChIKey | FMVOMKRBEWIUMB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |