C27H34N4O2 — CID 20968334
N-[3-[benzyl(butyl)amino]propyl]-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]acetamide (PubChem CID 20968334) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[3-[benzyl(butyl)amino]propyl]-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]acetamide.
| Compound Name | N-[3-[benzyl(butyl)amino]propyl]-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 20968334 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[3-[benzyl(butyl)amino]propyl]-2-[3-(4-methylphenyl)-6-oxopyridazin-1-yl]acetamide |
| SMILES | CCCCN(CCCNC(=O)Cn1nc(-c2ccc(C)cc2)ccc1=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H34N4O2/c1-3-4-18-30(20-23-9-6-5-7-10-23)19-8-17-28-26(32)21-31-27(33)16-15-25(29-31)24-13-11-22(2)12-14-24/h5-7,9-16H,3-4,8,17-21H2,1-2H3,(H,28,32) |
| InChIKey | LEEZDTFSLAINIL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|