About N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide
N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 20968993) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide.
Molecular Properties
| Compound Name | N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide |
| PubChem CID | 20968993 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)Nc2cnc3ccccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N2O4/c1-25-18-10-14(11-19(26-2)21(18)27-3)8-9-20(24)23-16-12-15-6-4-5-7-17(15)22-13-16/h4-7,10-13H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | UEFLYENOVPXTIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide?
The IUPAC name of N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide (CID 20968993) is N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide.
What is the SMILES notation for N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide?
The canonical SMILES for N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide is COc1cc(CCC(=O)Nc2cnc3ccccc3c2)cc(OC)c1OC.
What is the InChIKey of N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide?
The InChIKey is UEFLYENOVPXTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-25-18-10-14(11-19(26-2)21(18)27-3)8-9-20(24)23-16-12-15-6-4-5-7-17(15)22-13-16/h4-7,10-13H,8-9H2,1-3H3,(H,23,24).
What are the key properties of N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide?
N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide has a molecular weight of 366.42 g/mol, XLogP of 3.83, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-quinolin-3-yl-3-(3,4,5-trimethoxyphenyl)propanamide is sourced from PubChem (CID 20968993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).