C10H15N3O5S — CID 20969636
methyl 2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetate (PubChem CID 20969636) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is methyl 2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetate.
| Compound Name | methyl 2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 20969636 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | methyl 2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetate |
| SMILES | COC(=O)Cn1cnc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C10H15N3O5S/c1-17-10(14)7-12-6-9(11-8-12)19(15,16)13-2-4-18-5-3-13/h6,8H,2-5,7H2,1H3 |
| InChIKey | QHAOHJLBYPYWRZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |