C22H16ClN3O5S — CID 20969991
6-[[4-[(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20969991) has the molecular formula C22H16ClN3O5S and a molecular weight of 469.91 g/mol. Its IUPAC name is 6-[[4-[(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[4-[(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20969991 |
| Molecular Formula | C22H16ClN3O5S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 6-[[4-[(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)sulfonyl]phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)N2CCOc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C22H16ClN3O5S/c23-15-5-8-19-18(12-15)26(10-11-31-19)32(29,30)16-6-3-14(4-7-16)13-25-21(27)17-2-1-9-24-20(17)22(25)28/h1-9,12H,10-11,13H2 |
| InChIKey | FFWJFMOEJVAFBO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|