C24H23N3O6S — CID 20970070
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 20970070) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20970070 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(4-ethoxyphenyl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | CCOc1ccc(CNS(=O)(=O)c2cc(CN3C(=O)c4cccnc4C3=O)ccc2OC)cc1 |
| InChI | InChI=1S/C24H23N3O6S/c1-3-33-18-9-6-16(7-10-18)14-26-34(30,31)21-13-17(8-11-20(21)32-2)15-27-23(28)19-5-4-12-25-22(19)24(27)29/h4-13,26H,3,14-15H2,1-2H3 |
| InChIKey | NVKCPLGCDUYPGW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|