C24H22BrFN2O — CID 20970219
4-bromo-2-[4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 20970219) has the molecular formula C24H22BrFN2O and a molecular weight of 453.36 g/mol. Its IUPAC name is 4-bromo-2-[4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-bromo-2-[4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 20970219 |
| Molecular Formula | C24H22BrFN2O |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-bromo-2-[4-(4-ethylphenyl)-2-(4-fluorophenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCc1ccc(C2=NC(c3ccc(F)cc3)NC(c3cc(Br)ccc3O)C2)cc1 |
| InChI | InChI=1S/C24H22BrFN2O/c1-2-15-3-5-16(6-4-15)21-14-22(20-13-18(25)9-12-23(20)29)28-24(27-21)17-7-10-19(26)11-8-17/h3-13,22,24,28-29H,2,14H2,1H3 |
| InChIKey | MWZOWGXJKZQZBE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|