About 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol
4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol (PubChem CID 20970290) has the molecular formula C19H21ClN2O2
and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol.
Molecular Properties
| Compound Name | 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol |
| PubChem CID | 20970290 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol |
| SMILES | COc1cccc(C2=NC(C)(C)NC(c3cc(Cl)ccc3O)C2)c1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-19(2)21-16(12-5-4-6-14(9-12)24-3)11-17(22-19)15-10-13(20)7-8-18(15)23/h4-10,17,22-23H,11H2,1-3H3 |
| InChIKey | QCROZAMTXGFGND-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol?
The IUPAC name of 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol (CID 20970290) is 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol.
What is the SMILES notation for 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol?
The canonical SMILES for 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol is COc1cccc(C2=NC(C)(C)NC(c3cc(Cl)ccc3O)C2)c1.
What is the InChIKey of 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol?
The InChIKey is QCROZAMTXGFGND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O2/c1-19(2)21-16(12-5-4-6-14(9-12)24-3)11-17(22-19)15-10-13(20)7-8-18(15)23/h4-10,17,22-23H,11H2,1-3H3.
What are the key properties of 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol?
4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol has a molecular weight of 344.84 g/mol, XLogP of 4.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[4-(3-methoxyphenyl)-2,2-dimethyl-5,6-dihydro-1H-pyrimidin-6-yl]phenol is sourced from PubChem (CID 20970290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).