C24H22Cl2N2O3 — CID 20970321
2-[2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol (PubChem CID 20970321) has the molecular formula C24H22Cl2N2O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 20970321 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
| SMILES | COc1ccc(C2=NC(c3ccc(Cl)cc3Cl)NC(c3cccc(OC)c3O)C2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-30-16-9-6-14(7-10-16)20-13-21(18-4-3-5-22(31-2)23(18)29)28-24(27-20)17-11-8-15(25)12-19(17)26/h3-12,21,24,28-29H,13H2,1-2H3 |
| InChIKey | CCKWOVPSNGJAMT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|