C27H30N2O4 — CID 20970403
2-ethoxy-6-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 20970403) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-ethoxy-6-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-ethoxy-6-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 20970403 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-ethoxy-6-[2-(2-ethoxyphenyl)-4-(4-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCOc1ccccc1C1N=C(c2ccc(OC)cc2)CC(c2cccc(OCC)c2O)N1 |
| InChI | InChI=1S/C27H30N2O4/c1-4-32-24-11-7-6-9-21(24)27-28-22(18-13-15-19(31-3)16-14-18)17-23(29-27)20-10-8-12-25(26(20)30)33-5-2/h6-16,23,27,29-30H,4-5,17H2,1-3H3 |
| InChIKey | TVJMNNXMASTRCB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|