C25H25BrN2O2 — CID 20970488
4-bromo-2-[2-(2-ethoxyphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 20970488) has the molecular formula C25H25BrN2O2 and a molecular weight of 465.39 g/mol. Its IUPAC name is 4-bromo-2-[2-(2-ethoxyphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-bromo-2-[2-(2-ethoxyphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 20970488 |
| Molecular Formula | C25H25BrN2O2 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 4-bromo-2-[2-(2-ethoxyphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCOc1ccccc1C1N=C(c2ccc(C)cc2)CC(c2cc(Br)ccc2O)N1 |
| InChI | InChI=1S/C25H25BrN2O2/c1-3-30-24-7-5-4-6-19(24)25-27-21(17-10-8-16(2)9-11-17)15-22(28-25)20-14-18(26)12-13-23(20)29/h4-14,22,25,28-29H,3,15H2,1-2H3 |
| InChIKey | OWCWCTZTVCSETE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|