C28H33N3O3 — CID 20971739
N-cycloheptyl-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide (PubChem CID 20971739) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-cycloheptyl-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-cycloheptyl-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 20971739 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-cycloheptyl-2-[1-(2-phenyl-1,3-benzoxazole-6-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2ccc3nc(-c4ccccc4)oc3c2)CC1)NC1CCCCCC1 |
| InChI | InChI=1S/C28H33N3O3/c32-26(29-23-10-6-1-2-7-11-23)18-20-14-16-31(17-15-20)28(33)22-12-13-24-25(19-22)34-27(30-24)21-8-4-3-5-9-21/h3-5,8-9,12-13,19-20,23H,1-2,6-7,10-11,14-18H2,(H,29,32) |
| InChIKey | RFKXWYJNQLGJME-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |