C17H17N3O4S2 — CID 20971843
N-[5-[(4-methoxyphenyl)sulfonylamino]-1,3-benzothiazol-2-yl]propanamide (PubChem CID 20971843) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[5-[(4-methoxyphenyl)sulfonylamino]-1,3-benzothiazol-2-yl]propanamide.
| Compound Name | N-[5-[(4-methoxyphenyl)sulfonylamino]-1,3-benzothiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 20971843 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[5-[(4-methoxyphenyl)sulfonylamino]-1,3-benzothiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nc2cc(NS(=O)(=O)c3ccc(OC)cc3)ccc2s1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-3-16(21)19-17-18-14-10-11(4-9-15(14)25-17)20-26(22,23)13-7-5-12(24-2)6-8-13/h4-10,20H,3H2,1-2H3,(H,18,19,21) |
| InChIKey | DKQDHYFYRWZXDP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |