C25H33N3O5S — CID 20973983
N-(2-methoxyethyl)-1-[3-[(4-propan-2-ylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide (PubChem CID 20973983) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[3-[(4-propan-2-ylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[3-[(4-propan-2-ylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20973983 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-(2-methoxyethyl)-1-[3-[(4-propan-2-ylphenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(C(=O)c2cccc(NS(=O)(=O)c3ccc(C(C)C)cc3)c2)CC1 |
| InChI | InChI=1S/C25H33N3O5S/c1-18(2)19-7-9-23(10-8-19)34(31,32)27-22-6-4-5-21(17-22)25(30)28-14-11-20(12-15-28)24(29)26-13-16-33-3/h4-10,17-18,20,27H,11-16H2,1-3H3,(H,26,29) |
| InChIKey | VVGGKLIPWFBRNK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|