About (2,4-dinitrophenyl)methanol
(2,4-dinitrophenyl)methanol (PubChem CID 20974) has the molecular formula C7H6N2O5
and a molecular weight of 198.13 g/mol. Its IUPAC name is (2,4-dinitrophenyl)methanol.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl)methanol |
| PubChem CID | 20974 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | (2,4-dinitrophenyl)methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-3,10H,4H2 |
| InChIKey | ZKKOBDGQUYKWFN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl)methanol?
The IUPAC name of (2,4-dinitrophenyl)methanol (CID 20974) is (2,4-dinitrophenyl)methanol.
What is the SMILES notation for (2,4-dinitrophenyl)methanol?
The canonical SMILES for (2,4-dinitrophenyl)methanol is O=[N+]([O-])c1ccc(CO)c([N+](=O)[O-])c1.
What is the InChIKey of (2,4-dinitrophenyl)methanol?
The InChIKey is ZKKOBDGQUYKWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-3,10H,4H2.
What are the key properties of (2,4-dinitrophenyl)methanol?
(2,4-dinitrophenyl)methanol has a molecular weight of 198.13 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl)methanol is sourced from PubChem (CID 20974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).