About N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide (PubChem CID 20974844) has the molecular formula C23H25N3O2S2
and a molecular weight of 439.61 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide |
| PubChem CID | 20974844 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1csc(-c2ccccc2)n1)C1CCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H25N3O2S2/c27-21(15-20-7-4-14-29-20)26-12-9-17(10-13-26)22(28)24-11-8-19-16-30-23(25-19)18-5-2-1-3-6-18/h1-7,14,16-17H,8-13,15H2,(H,24,28) |
| InChIKey | KQXYDWSHMAEFHO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide?
The IUPAC name of N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide (CID 20974844) is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide.
What is the SMILES notation for N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide?
The canonical SMILES for N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide is O=C(NCCc1csc(-c2ccccc2)n1)C1CCN(C(=O)Cc2cccs2)CC1.
What is the InChIKey of N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide?
The InChIKey is KQXYDWSHMAEFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2S2/c27-21(15-20-7-4-14-29-20)26-12-9-17(10-13-26)22(28)24-11-8-19-16-30-23(25-19)18-5-2-1-3-6-18/h1-7,14,16-17H,8-13,15H2,(H,24,28).
What are the key properties of N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide?
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide has a molecular weight of 439.61 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]-1-(2-thiophen-2-ylacetyl)piperidine-4-carboxamide is sourced from PubChem (CID 20974844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).