About 1,2-dichlorocyclopropene
1,2-dichlorocyclopropene (PubChem CID 20975380) has the molecular formula C3H2Cl2
and a molecular weight of 108.95 g/mol. Its IUPAC name is 1,2-dichlorocyclopropene.
Molecular Properties
| Compound Name | 1,2-dichlorocyclopropene |
| PubChem CID | 20975380 |
| Molecular Formula | C3H2Cl2 |
| Molecular Weight | 108.95 g/mol |
| Exact Mass | 107.95 |
| IUPAC Name | 1,2-dichlorocyclopropene |
| SMILES | ClC1=C(Cl)C1 |
| InChI | InChI=1S/C3H2Cl2/c4-2-1-3(2)5/h1H2 |
| InChIKey | MIWGFVCCCKZKCS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.95 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichlorocyclopropene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorocyclopropene?
The IUPAC name of 1,2-dichlorocyclopropene (CID 20975380) is 1,2-dichlorocyclopropene.
What is the SMILES notation for 1,2-dichlorocyclopropene?
The canonical SMILES for 1,2-dichlorocyclopropene is ClC1=C(Cl)C1.
What is the InChIKey of 1,2-dichlorocyclopropene?
The InChIKey is MIWGFVCCCKZKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2Cl2/c4-2-1-3(2)5/h1H2.
What are the key properties of 1,2-dichlorocyclopropene?
1,2-dichlorocyclopropene has a molecular weight of 108.95 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorocyclopropene is sourced from PubChem (CID 20975380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).