C6H15N5O6P2S2-6 — CID 20975411
methane;6-methyl-1,3,5-triazine-2,4-diamine;dithiophosphate (PubChem CID 20975411) has the molecular formula C6H15N5O6P2S2-6 and a molecular weight of 379.30 g/mol. Its IUPAC name is methane;6-methyl-1,3,5-triazine-2,4-diamine;dithiophosphate.
| Compound Name | methane;6-methyl-1,3,5-triazine-2,4-diamine;dithiophosphate |
|---|---|
| PubChem CID | 20975411 |
| Molecular Formula | C6H15N5O6P2S2-6 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | methane;6-methyl-1,3,5-triazine-2,4-diamine;dithiophosphate |
| SMILES | C.C.Cc1nc(N)nc(N)n1.[O-]P([O-])([O-])=S.[O-]P([O-])([O-])=S |
| InChI | InChI=1S/C4H7N5.2CH4.2H3O3PS/c1-2-7-3(5)9-4(6)8-2;;;2*1-4(2,3)5/h1H3,(H4,5,6,7,8,9);2*1H4;2*(H3,1,2,3,5)/p-6 |
| InChIKey | MEEFYOJLKAYRKK-UHFFFAOYSA-H |
| XLogP | -4.80 |
| TPSA | 229.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|