About 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione
7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione (PubChem CID 20975581) has the molecular formula C21H38O6
and a molecular weight of 386.53 g/mol. Its IUPAC name is 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione.
Molecular Properties
| Compound Name | 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione |
| PubChem CID | 20975581 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione |
| SMILES | CCCCCC(=O)C(O)(CO)C(O)(C(=O)CCCCC)C(=O)CCCCC |
| InChI | InChI=1S/C21H38O6/c1-4-7-10-13-17(23)20(26,16-22)21(27,18(24)14-11-8-5-2)19(25)15-12-9-6-3/h22,26-27H,4-16H2,1-3H3 |
| InChIKey | QWUJTPYRUVYKSV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione?
The IUPAC name of 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione (CID 20975581) is 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione.
What is the SMILES notation for 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione?
The canonical SMILES for 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione is CCCCCC(=O)C(O)(CO)C(O)(C(=O)CCCCC)C(=O)CCCCC.
What is the InChIKey of 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione?
The InChIKey is QWUJTPYRUVYKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O6/c1-4-7-10-13-17(23)20(26,16-22)21(27,18(24)14-11-8-5-2)19(25)15-12-9-6-3/h22,26-27H,4-16H2,1-3H3.
What are the key properties of 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione?
7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione has a molecular weight of 386.53 g/mol, XLogP of 2.89, 17 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hexanoyl-7,8-dihydroxy-8-(hydroxymethyl)tetradecane-6,9-dione is sourced from PubChem (CID 20975581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).