About 1-(4-chlorophenyl)ethyl carbamate
1-(4-chlorophenyl)ethyl carbamate (PubChem CID 20975716) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)ethyl carbamate.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)ethyl carbamate |
| PubChem CID | 20975716 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-(4-chlorophenyl)ethyl carbamate |
| SMILES | CC(OC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClNO2/c1-6(13-9(11)12)7-2-4-8(10)5-3-7/h2-6H,1H3,(H2,11,12) |
| InChIKey | GKQAGMOHTBQWKN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)ethyl carbamate?
The IUPAC name of 1-(4-chlorophenyl)ethyl carbamate (CID 20975716) is 1-(4-chlorophenyl)ethyl carbamate.
What is the SMILES notation for 1-(4-chlorophenyl)ethyl carbamate?
The canonical SMILES for 1-(4-chlorophenyl)ethyl carbamate is CC(OC(N)=O)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)ethyl carbamate?
The InChIKey is GKQAGMOHTBQWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2/c1-6(13-9(11)12)7-2-4-8(10)5-3-7/h2-6H,1H3,(H2,11,12).
What are the key properties of 1-(4-chlorophenyl)ethyl carbamate?
1-(4-chlorophenyl)ethyl carbamate has a molecular weight of 199.64 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)ethyl carbamate is sourced from PubChem (CID 20975716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).