About aziridin-2-one;naphthalene
aziridin-2-one;naphthalene (PubChem CID 20975737) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is aziridin-2-one;naphthalene.
Molecular Properties
| Compound Name | aziridin-2-one;naphthalene |
| PubChem CID | 20975737 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | aziridin-2-one;naphthalene |
| SMILES | O=C1CN1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C2H3NO/c1-2-6-10-8-4-3-7-9(10)5-1;4-2-1-3-2/h1-8H;1H2,(H,3,4) |
| InChIKey | JLUWTLLBJBSJKZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-2-one;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-2-one;naphthalene?
The IUPAC name of aziridin-2-one;naphthalene (CID 20975737) is aziridin-2-one;naphthalene.
What is the SMILES notation for aziridin-2-one;naphthalene?
The canonical SMILES for aziridin-2-one;naphthalene is O=C1CN1.c1ccc2ccccc2c1.
What is the InChIKey of aziridin-2-one;naphthalene?
The InChIKey is JLUWTLLBJBSJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C2H3NO/c1-2-6-10-8-4-3-7-9(10)5-1;4-2-1-3-2/h1-8H;1H2,(H,3,4).
What are the key properties of aziridin-2-one;naphthalene?
aziridin-2-one;naphthalene has a molecular weight of 185.23 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-2-one;naphthalene is sourced from PubChem (CID 20975737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).