C29H33NO12-4 — CID 20976129
2-[4-[2-[2-(diethylamino)ethoxy]ethyl]-2-phenyl-1,3-benzodioxol-2-yl]acetate;2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 20976129) has the molecular formula C29H33NO12-4 and a molecular weight of 587.58 g/mol. Its IUPAC name is 2-[4-[2-[2-(diethylamino)ethoxy]ethyl]-2-phenyl-1,3-benzodioxol-2-yl]acetate;2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 2-[4-[2-[2-(diethylamino)ethoxy]ethyl]-2-phenyl-1,3-benzodioxol-2-yl]acetate;2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 20976129 |
| Molecular Formula | C29H33NO12-4 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 2-[4-[2-[2-(diethylamino)ethoxy]ethyl]-2-phenyl-1,3-benzodioxol-2-yl]acetate;2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCN(CC)CCOCCc1cccc2c1OC(CC(=O)[O-])(c1ccccc1)O2.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C23H29NO5.C6H8O7/c1-3-24(4-2)14-16-27-15-13-18-9-8-12-20-22(18)29-23(28-20,17-21(25)26)19-10-6-5-7-11-19;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-12H,3-4,13-17H2,1-2H3,(H,25,26);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-4 |
| InChIKey | FJWDYHYOXMHMLT-UHFFFAOYSA-J |
| XLogP | -2.90 |
| TPSA | 211.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|