About [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 2097616) has the molecular formula C25H21Cl2NO4
and a molecular weight of 470.35 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
Molecular Properties
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| PubChem CID | 2097616 |
| Molecular Formula | C25H21Cl2NO4 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H21Cl2NO4/c1-16-6-8-18(9-7-16)24(30)20-4-2-3-5-21(20)25(31)32-15-23(29)28-13-12-17-10-11-19(26)14-22(17)27/h2-11,14H,12-13,15H2,1H3,(H,28,29) |
| InChIKey | JXOFSHHKGWLZJT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate?
The IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (CID 2097616) is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
What is the SMILES notation for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate?
The canonical SMILES for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate is Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NCCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate?
The InChIKey is JXOFSHHKGWLZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21Cl2NO4/c1-16-6-8-18(9-7-16)24(30)20-4-2-3-5-21(20)25(31)32-15-23(29)28-13-12-17-10-11-19(26)14-22(17)27/h2-11,14H,12-13,15H2,1H3,(H,28,29).
What are the key properties of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate?
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate has a molecular weight of 470.35 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate is sourced from PubChem (CID 2097616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).