C13H12OS — CID 20976503
(2,5-dimethylphenyl)-(furan-3-yl)methanethione (PubChem CID 20976503) has the molecular formula C13H12OS and a molecular weight of 216.30 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(furan-3-yl)methanethione.
| Compound Name | (2,5-dimethylphenyl)-(furan-3-yl)methanethione |
|---|---|
| PubChem CID | 20976503 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (2,5-dimethylphenyl)-(furan-3-yl)methanethione |
| SMILES | Cc1ccc(C)c(C(=S)c2ccoc2)c1 |
| InChI | InChI=1S/C13H12OS/c1-9-3-4-10(2)12(7-9)13(15)11-5-6-14-8-11/h3-8H,1-2H3 |
| InChIKey | OEUYJJZQPSLMIJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|