C6H3F9 — CID 20976781
1,1,1,3,4,4,5,5,5-nonafluoro-2-methylpent-2-ene (PubChem CID 20976781) has the molecular formula C6H3F9 and a molecular weight of 246.07 g/mol. Its IUPAC name is 1,1,1,3,4,4,5,5,5-nonafluoro-2-methylpent-2-ene.
| Compound Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-methylpent-2-ene |
|---|---|
| PubChem CID | 20976781 |
| Molecular Formula | C6H3F9 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-methylpent-2-ene |
| SMILES | CC(=C(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F9/c1-2(5(10,11)12)3(7)4(8,9)6(13,14)15/h1H3 |
| InChIKey | XDEACWGUWLUYFX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|