About 1-(aminodiazenyl)-2,3,4-trimethylbenzene
1-(aminodiazenyl)-2,3,4-trimethylbenzene (PubChem CID 20976812) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(aminodiazenyl)-2,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 1-(aminodiazenyl)-2,3,4-trimethylbenzene |
| PubChem CID | 20976812 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-(aminodiazenyl)-2,3,4-trimethylbenzene |
| SMILES | Cc1ccc(/N=N/N)c(C)c1C |
| InChI | InChI=1S/C9H13N3/c1-6-4-5-9(11-12-10)8(3)7(6)2/h4-5H,1-3H3,(H2,10,11) |
| InChIKey | ULHDWPTVSQUJNP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminodiazenyl)-2,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminodiazenyl)-2,3,4-trimethylbenzene?
The IUPAC name of 1-(aminodiazenyl)-2,3,4-trimethylbenzene (CID 20976812) is 1-(aminodiazenyl)-2,3,4-trimethylbenzene.
What is the SMILES notation for 1-(aminodiazenyl)-2,3,4-trimethylbenzene?
The canonical SMILES for 1-(aminodiazenyl)-2,3,4-trimethylbenzene is Cc1ccc(/N=N/N)c(C)c1C.
What is the InChIKey of 1-(aminodiazenyl)-2,3,4-trimethylbenzene?
The InChIKey is ULHDWPTVSQUJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-4-5-9(11-12-10)8(3)7(6)2/h4-5H,1-3H3,(H2,10,11).
What are the key properties of 1-(aminodiazenyl)-2,3,4-trimethylbenzene?
1-(aminodiazenyl)-2,3,4-trimethylbenzene has a molecular weight of 163.22 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminodiazenyl)-2,3,4-trimethylbenzene is sourced from PubChem (CID 20976812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).