About 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid
1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid (PubChem CID 20977237) has the molecular formula C14H21NO5S
and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid.
Molecular Properties
| Compound Name | 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid |
| PubChem CID | 20977237 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid |
| SMILES | CCc1cccc(CC)c1C(OC)C(=O)C(N)S(=O)(=O)O |
| InChI | InChI=1S/C14H21NO5S/c1-4-9-7-6-8-10(5-2)11(9)13(20-3)12(16)14(15)21(17,18)19/h6-8,13-14H,4-5,15H2,1-3H3,(H,17,18,19) |
| InChIKey | VGIUSOWRYDHKSZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid?
The IUPAC name of 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid (CID 20977237) is 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid.
What is the SMILES notation for 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid?
The canonical SMILES for 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid is CCc1cccc(CC)c1C(OC)C(=O)C(N)S(=O)(=O)O.
What is the InChIKey of 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid?
The InChIKey is VGIUSOWRYDHKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5S/c1-4-9-7-6-8-10(5-2)11(9)13(20-3)12(16)14(15)21(17,18)19/h6-8,13-14H,4-5,15H2,1-3H3,(H,17,18,19).
What are the key properties of 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid?
1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid has a molecular weight of 315.39 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,6-diethylphenyl)-3-methoxy-2-oxopropane-1-sulfonic acid is sourced from PubChem (CID 20977237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).