About N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide
N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide (PubChem CID 20977656) has the molecular formula C6H3N9O12
and a molecular weight of 393.14 g/mol. Its IUPAC name is N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide.
Molecular Properties
| Compound Name | N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide |
| PubChem CID | 20977656 |
| Molecular Formula | C6H3N9O12 |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide |
| SMILES | O=[N+]([O-])Nc1c([N+](=O)[O-])c(N[N+](=O)[O-])c([N+](=O)[O-])c(N[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N9O12/c16-10(17)4-1(7-13(22)23)5(11(18)19)3(9-15(26)27)6(12(20)21)2(4)8-14(24)25/h7-9H |
| InChIKey | PBFAVXPWNNQAJY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 294.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide?
The IUPAC name of N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide (CID 20977656) is N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide.
What is the SMILES notation for N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide?
The canonical SMILES for N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide is O=[N+]([O-])Nc1c([N+](=O)[O-])c(N[N+](=O)[O-])c([N+](=O)[O-])c(N[N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide?
The InChIKey is PBFAVXPWNNQAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N9O12/c16-10(17)4-1(7-13(22)23)5(11(18)19)3(9-15(26)27)6(12(20)21)2(4)8-14(24)25/h7-9H.
What are the key properties of N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide?
N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide has a molecular weight of 393.14 g/mol, XLogP of 0.22, 9 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dinitramido-2,4,6-trinitrophenyl)nitramide is sourced from PubChem (CID 20977656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).