About (2-amino-2-oxoethyl) 4-phenylbenzoate
(2-amino-2-oxoethyl) 4-phenylbenzoate (PubChem CID 2097777) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-phenylbenzoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 4-phenylbenzoate |
| PubChem CID | 2097777 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-phenylbenzoate |
| SMILES | NC(=O)COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H13NO3/c16-14(17)10-19-15(18)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2,(H2,16,17) |
| InChIKey | DXASGLZJAYFWAT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-2-oxoethyl) 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 4-phenylbenzoate?
The IUPAC name of (2-amino-2-oxoethyl) 4-phenylbenzoate (CID 2097777) is (2-amino-2-oxoethyl) 4-phenylbenzoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 4-phenylbenzoate?
The canonical SMILES for (2-amino-2-oxoethyl) 4-phenylbenzoate is NC(=O)COC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2-amino-2-oxoethyl) 4-phenylbenzoate?
The InChIKey is DXASGLZJAYFWAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c16-14(17)10-19-15(18)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2,(H2,16,17).
What are the key properties of (2-amino-2-oxoethyl) 4-phenylbenzoate?
(2-amino-2-oxoethyl) 4-phenylbenzoate has a molecular weight of 255.27 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 4-phenylbenzoate is sourced from PubChem (CID 2097777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).